3-(Aminomethyl)-4-methylpyridin-2-amine

• CAS: 1341367-69-8
• Catalog Number: ACM1341367698
• Category: Pyridines
• Molecular Weight: 137.18
• Molecular Formula: C7H11N3

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C7H11N3.

What are the synonyms of the compound?

The synonyms of the compound are 3-(aminomethyl)-4-methylpyridin-2-amine, 1341367-69-8, AKOS013446018, and SB55164.

What is the molecular weight of the compound?

The molecular weight of the compound is 137.18 g/mol.

When was the compound created and last modified?

The compound was created on October 23, 2012, and last modified on December 30, 2023.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3-(aminomethyl)-4-methylpyridin-2-amine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C7H11N3/c1-5-2-3-10-7(9)6(5)4-8/h2-3H,4,8H2,1H3,(H2,9,10).

What is the InChIKey of the compound?

The InChIKey of the compound is QCEIECPEDHMQNG-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC1=C(C(=NC=C1)N)CN.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 0.3.

What is the hydrogen bond acceptor count of the compound?

The hydrogen bond acceptor count of the compound is 3.