What is the molecular formula of 6-Bromo-2-(3-methoxyphenyl)quinoline-4-carboxylic acid?
The molecular formula is C17H12BrNO3.
What is the molecular weight of 6-Bromo-2-(3-methoxyphenyl)quinoline-4-carboxylic acid?
The molecular weight is 358.2 g/mol.
When was 6-Bromo-2-(3-methoxyphenyl)quinoline-4-carboxylic acid created?
It was created on July 9, 2005.
When was 6-Bromo-2-(3-methoxyphenyl)quinoline-4-carboxylic acid last modified?
It was last modified on December 2, 2023.
What is the IUPAC name of 6-Bromo-2-(3-methoxyphenyl)quinoline-4-carboxylic acid?
The IUPAC name is 6-bromo-2-(3-methoxyphenyl)quinoline-4-carboxylic acid.
What is the InChI of 6-Bromo-2-(3-methoxyphenyl)quinoline-4-carboxylic acid?
The InChI is InChI=1S/C17H12BrNO3/c1-22-12-4-2-3-10(7-12)16-9-14(17(20)21)13-8-11(18)5-6-15(13)19-16/h2-9H,1H3,(H,20,21).
What is the InChIKey of 6-Bromo-2-(3-methoxyphenyl)quinoline-4-carboxylic acid?
The InChIKey is OSGMFZLPSOECIH-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Bromo-2-(3-methoxyphenyl)quinoline-4-carboxylic acid?
The canonical SMILES is COC1=CC=CC(=C1)C2=NC3=C(C=C(C=C3)Br)C(=C2)C(=O)O.
What is the XLogP3-AA of 6-Bromo-2-(3-methoxyphenyl)quinoline-4-carboxylic acid?
The XLogP3-AA is 4.
What is the hydrogen bond donor count of 6-Bromo-2-(3-methoxyphenyl)quinoline-4-carboxylic acid?
The hydrogen bond donor count is 1.