2-(4-Bromo-phenyl)-quinoline-4-carboxylic acid hydrazide

• CAS: 351899-02-0
• Catalog Number: ACM351899020
• Category: Bromine Series
• Molecular Weight: 342.19
• Molecular Formula: C₁₆H₁₂BrN₃O
• Synonyms: 2-(4-BROMO-PHENYL)-QUINOLINE-4-CARBOXYLIC ACID HYDRAZIDE

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C16H12BrN3O.

What are the synonyms of the compound?

The synonyms of the compound are 2-(4-bromophenyl)quinoline-4-carbohydrazide and 2-(4-bromo-phenyl)-quinoline-4-carboxylic acid hydrazide.

When was the compound created and last modified?

The compound was created on July 19, 2005, and last modified on December 2, 2023.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-(4-bromophenyl)quinoline-4-carbohydrazide.

What is the InChIKey of the compound?

The InChIKey of the compound is TVLQRCVLQVHHQI-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is C1=CC=C2C(=C1)C(=CC(=N2)C3=CC=C(C=C3)Br)C(=O)NN.

What is the molecular weight of the compound?

The molecular weight of the compound is 342.19 g/mol.

How many hydrogen bond donor counts does the compound have?

The compound has 2 hydrogen bond donor counts.

What is the exact mass of the compound?

The exact mass of the compound is 341.01637 g/mol.

Is the compound canonicalized?

Yes, the compound is canonicalized.