5-(trifluoromethyl)pyrazine-2-carboxylic acid

• CAS: 1060814-50-7
• Catalog Number: ACM1060814507
• Category: Pyrazines
• Molecular Weight: 192.0
• Molecular Formula: C6H3F3N2O2
• Appearance: Off-white Powder

Custom Q&A

What is the molecular formula of 5-(trifluoromethyl)pyrazine-2-carboxylic acid?

The molecular formula is C6H3F3N2O2.

What is the molecular weight of 5-(trifluoromethyl)pyrazine-2-carboxylic acid?

The molecular weight is 192.10 g/mol.

What is the IUPAC name of 5-(trifluoromethyl)pyrazine-2-carboxylic acid?

The IUPAC name is 5-(trifluoromethyl)pyrazine-2-carboxylic acid.

What is the InChI of 5-(trifluoromethyl)pyrazine-2-carboxylic acid?

The InChI is InChI=1S/C6H3F3N2O2/c7-6(8,9)4-2-10-3(1-11-4)5(12)13/h1-2H,(H,12,13).

What is the InChIKey of 5-(trifluoromethyl)pyrazine-2-carboxylic acid?

The InChIKey is DDVCRZPGVDGULO-UHFFFAOYSA-N.

What is the Canonical SMILES of 5-(trifluoromethyl)pyrazine-2-carboxylic acid?

The Canonical SMILES is C1=C(N=CC(=N1)C(F)(F)F)C(=O)O.

What is the XLogP3-AA value of 5-(trifluoromethyl)pyrazine-2-carboxylic acid?

The XLogP3-AA value is 0.6.

How many hydrogen bond donor counts does 5-(trifluoromethyl)pyrazine-2-carboxylic acid have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 5-(trifluoromethyl)pyrazine-2-carboxylic acid have?

It has 7 hydrogen bond acceptor counts.

How many rotatable bond counts does 5-(trifluoromethyl)pyrazine-2-carboxylic acid have?

It has 1 rotatable bond count.