What is the molecular formula of 5-(trifluoromethyl)pyrazine-2-carboxylic acid?
The molecular formula is C6H3F3N2O2.
What is the molecular weight of 5-(trifluoromethyl)pyrazine-2-carboxylic acid?
The molecular weight is 192.10 g/mol.
What is the IUPAC name of 5-(trifluoromethyl)pyrazine-2-carboxylic acid?
The IUPAC name is 5-(trifluoromethyl)pyrazine-2-carboxylic acid.
What is the InChI of 5-(trifluoromethyl)pyrazine-2-carboxylic acid?
The InChI is InChI=1S/C6H3F3N2O2/c7-6(8,9)4-2-10-3(1-11-4)5(12)13/h1-2H,(H,12,13).
What is the InChIKey of 5-(trifluoromethyl)pyrazine-2-carboxylic acid?
The InChIKey is DDVCRZPGVDGULO-UHFFFAOYSA-N.
What is the Canonical SMILES of 5-(trifluoromethyl)pyrazine-2-carboxylic acid?
The Canonical SMILES is C1=C(N=CC(=N1)C(F)(F)F)C(=O)O.
What is the XLogP3-AA value of 5-(trifluoromethyl)pyrazine-2-carboxylic acid?
The XLogP3-AA value is 0.6.
How many hydrogen bond donor counts does 5-(trifluoromethyl)pyrazine-2-carboxylic acid have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 5-(trifluoromethyl)pyrazine-2-carboxylic acid have?
It has 7 hydrogen bond acceptor counts.
How many rotatable bond counts does 5-(trifluoromethyl)pyrazine-2-carboxylic acid have?
It has 1 rotatable bond count.