3,6-dimethylpyrazine-2-carbonitrile

• CAS: 2435-47-4
• Catalog Number: ACM2435474
• Category: Pyrazines
• Molecular Weight: 133.1
• Molecular Formula: C7H7N3
• Appearance: White Powder

Custom Q&A

What is the molecular formula of 3,6-dimethylpyrazine-2-carbonitrile?

The molecular formula is C7H7N3.

What is the molecular weight of 3,6-dimethylpyrazine-2-carbonitrile?

The molecular weight is 133.15 g/mol.

What is the IUPAC name of 3,6-dimethylpyrazine-2-carbonitrile?

The IUPAC name is 3,6-dimethylpyrazine-2-carbonitrile.

What is the InChI of 3,6-dimethylpyrazine-2-carbonitrile?

The InChI is InChI=1S/C7H7N3/c1-5-4-9-6(2)7(3-8)10-5/h4H,1-2H3.

What is the InChIKey of 3,6-dimethylpyrazine-2-carbonitrile?

The InChIKey is NCKKBZUIFHHRBY-UHFFFAOYSA-N.

What is the canonical SMILES of 3,6-dimethylpyrazine-2-carbonitrile?

The canonical SMILES is CC1=CN=C(C(=N1)C#N)C.

What is the CAS number of 3,6-dimethylpyrazine-2-carbonitrile?

The CAS number is 2435-47-4.

What is the XLogP3 value of 3,6-dimethylpyrazine-2-carbonitrile?

The XLogP3 value is 0.6.

How many hydrogen bond donor counts does 3,6-dimethylpyrazine-2-carbonitrile have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 3,6-dimethylpyrazine-2-carbonitrile have?

It has 3 hydrogen bond acceptor counts.