CAS
1708974-12-2 Purity
---
1708974-12-2 Purity
---
Inquiry Basket
5-(Methylsulfonyl)pyridin-3-amine
CAS
1067530-19-1
Catalog Number
ACM1067530191
Category
Pyridines
Molecular Weight
172.2
Molecular Formula
C6H8N2O2S
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is 5-methylsulfonylpyridin-3-amine.
What is the molecular formula of the compound?
The molecular formula of the compound is C6H8N2O2S.
What is the molecular weight of the compound?
The molecular weight of the compound is 172.21 g/mol.
When was the compound created?
The compound was created on August 20, 2012.
When was the compound last modified?
The compound was last modified on December 30, 2023.
What is the InChI key of the compound?
The InChI key of the compound is JGIVFUZYNGOHHY-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is CS(=O)(=O)C1=CN=CC(=C1)N.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is -0.6.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
Recommended Products
