5-Chloro-6-iodopyridine-2,3-diamine

• CAS: 1394373-23-9
• Catalog Number: ACM1394373239
• Category: Pyridines
• Molecular Weight: 269.47
• Molecular Formula: C5H5ClIN3

Custom Q&A

What is the molecular formula of 5-Chloro-6-iodopyridine-2,3-diamine?

The molecular formula is C5H5ClIN3.

What is the molecular weight of 5-Chloro-6-iodopyridine-2,3-diamine?

The molecular weight is 269.47 g/mol.

What is the IUPAC name of 5-Chloro-6-iodopyridine-2,3-diamine?

The IUPAC name is 5-chloro-6-iodopyridine-2,3-diamine.

What is the InChI of 5-Chloro-6-iodopyridine-2,3-diamine?

The InChI is InChI=1S/C5H5ClIN3/c6-2-1-3(8)5(9)10-4(2)7/h1H,8H2,(H2,9,10).

What is the InChIKey of 5-Chloro-6-iodopyridine-2,3-diamine?

The InChIKey is HMQJGGSXOZIWMD-UHFFFAOYSA-N.

What is the Canonical SMILES of 5-Chloro-6-iodopyridine-2,3-diamine?

The Canonical SMILES is C1=C(C(=NC(=C1Cl)I)N)N.

What is the CAS number of 5-Chloro-6-iodopyridine-2,3-diamine?

The CAS number is 1394373-23-9.

What is the XLogP3-AA of 5-Chloro-6-iodopyridine-2,3-diamine?

The XLogP3-AA is 1.1.

What is the hydrogen bond donor count of 5-Chloro-6-iodopyridine-2,3-diamine?

The hydrogen bond donor count is 2.

What is the hydrogen bond acceptor count of 5-Chloro-6-iodopyridine-2,3-diamine?

The hydrogen bond acceptor count is 3.