What is the molecular formula of 5-Methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride?
The molecular formula is C7H5ClN2O2S2.
What is the molecular weight of 5-Methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride?
The molecular weight is 248.7 g/mol.
When was 5-Methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride created?
It was created on July 19, 2005.
When was 5-Methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride last modified?
It was last modified on November 25, 2023.
What is the IUPAC name of 5-Methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride?
The IUPAC name is 5-methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride.
What is the InChI of 5-Methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride?
The InChI is InChI=1S/C7H5ClN2O2S2/c1-4-2-3-5-6(10-13-9-5)7(4)14(8,11)12/h2-3H,1H3.
What is the InChIKey of 5-Methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride?
The InChIKey is TWWDPSJSTXBULL-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride?
The canonical SMILES is CC1=C(C2=NSN=C2C=C1)S(=O)(=O)Cl.
How many hydrogen bond donors does 5-Methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride have?
It has 0 hydrogen bond donors.
How many hydrogen bond acceptors does 5-Methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride have?
It has 5 hydrogen bond acceptors.