6-Bromo-imidazo[1,2-a]pyridin-8-amine

• Catalog Number: ACMA00000615
• Category: Alkenyl
• Molecular Weight: 212.05
• Molecular Formula: C₇H₃ClO₂S₂
• Hazard Statements: H226-H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS02

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C7H6BrN3.

What is the molecular weight of the compound?

The molecular weight of the compound is 212.05 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 6-bromoimidazo[1,2-a]pyridin-8-amine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C7H6BrN3/c8-5-3-6(9)7-10-1-2-11(7)4-5/h1-4H,9H2.

What is the InChIKey of the compound?

The InChIKey of the compound is NBHRWSCVWCCKDN-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1=CN2C=C(C=C(C2=N1)N)Br.

What is the CAS number of the compound?

The CAS number of the compound is 676371-00-9.

What is the DSSTox Substance ID of the compound?

The DSSTox Substance ID of the compound is DTXSID90590485.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 1.8.

Is the compound canonicalized?

Yes, the compound is canonicalized.