CAS
214360-66-4 Purity
---
214360-66-4 Purity
---
Inquiry Basket
5-Ethoxypyridine-3-boronicacidpinacolester
CAS
1171892-40-2
Catalog Number
ACM1171892402
Category
Boronic Esters
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 5-Ethoxypyridine-3-boronicacidpinacolester?
The molecular formula of 5-Ethoxypyridine-3-boronicacidpinacolester is C13H20BNO3.
What is the IUPAC name of 5-Ethoxypyridine-3-boronicacidpinacolester?
The IUPAC name of 5-Ethoxypyridine-3-boronicacidpinacolester is 3-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
What is the InChI key of 5-Ethoxypyridine-3-boronicacidpinacolester?
The InChI key of 5-Ethoxypyridine-3-boronicacidpinacolester is MSTJSRQLRFPSAI-UHFFFAOYSA-N.
What is the canonical SMILES notation of 5-Ethoxypyridine-3-boronicacidpinacolester?
The canonical SMILES notation of 5-Ethoxypyridine-3-boronicacidpinacolester is B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)OCC.
What is the molecular weight of 5-Ethoxypyridine-3-boronicacidpinacolester?
The molecular weight of 5-Ethoxypyridine-3-boronicacidpinacolester is 249.12 g/mol.
How many hydrogen bond donor counts does 5-Ethoxypyridine-3-boronicacidpinacolester have?
5-Ethoxypyridine-3-boronicacidpinacolester has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 5-Ethoxypyridine-3-boronicacidpinacolester have?
5-Ethoxypyridine-3-boronicacidpinacolester has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does 5-Ethoxypyridine-3-boronicacidpinacolester have?
5-Ethoxypyridine-3-boronicacidpinacolester has 3 rotatable bond counts.
What is the topological polar surface area of 5-Ethoxypyridine-3-boronicacidpinacolester?
The topological polar surface area of 5-Ethoxypyridine-3-boronicacidpinacolester is 40.6Ų.
How many heavy atom counts does 5-Ethoxypyridine-3-boronicacidpinacolester have?
5-Ethoxypyridine-3-boronicacidpinacolester has 18 heavy atom counts.
Recommended Products
