What is the molecular formula of 4-Methoxycarbonylphenylboronic acid pinacol ester?
The molecular formula is C14H19BO4.
What is the molecular weight of 4-Methoxycarbonylphenylboronic acid pinacol ester?
The molecular weight is 262.11 g/mol.
What is the IUPAC name of 4-Methoxycarbonylphenylboronic acid pinacol ester?
The IUPAC name is methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
What is the InChI of 4-Methoxycarbonylphenylboronic acid pinacol ester?
The InChI is InChI=1S/C14H19BO4/c1-13(2)14(3,4)19-15(18-13)11-8-6-10(7-9-11)12(16)17-5/h6-9H,1-5H3.
What is the InChIKey of 4-Methoxycarbonylphenylboronic acid pinacol ester?
The InChIKey is REIZEQZILPXYKS-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Methoxycarbonylphenylboronic acid pinacol ester?
The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)OC.
What is the CAS number of 4-Methoxycarbonylphenylboronic acid pinacol ester?
The CAS number is 171364-80-0.
What is the DSSTox Substance ID for 4-Methoxycarbonylphenylboronic acid pinacol ester?
The DSSTox Substance ID is DTXSID10378500.
How many hydrogen bond acceptor count does 4-Methoxycarbonylphenylboronic acid pinacol ester have?
It has 4 hydrogen bond acceptor count.
What is the topological polar surface area of 4-Methoxycarbonylphenylboronic acid pinacol ester?
The topological polar surface area is 44.8Ų.