CAS
947533-39-3 Purity
95%
947533-39-3 Purity
95%
Inquiry Basket
5-(Ethoxycarbonyl)pyridine-3-boronicacid
CAS
875781-62-7
Catalog Number
ACM875781627
Category
Boro-Amino Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 5-(Ethoxycarbonyl)pyridine-3-boronic acid?
The molecular formula of 5-(Ethoxycarbonyl)pyridine-3-boronic acid is C8H10BNO4.
What is the molecular weight of 5-(Ethoxycarbonyl)pyridine-3-boronic acid?
The molecular weight of 5-(Ethoxycarbonyl)pyridine-3-boronic acid is 194.98 g/mol.
What is the IUPAC name of 5-(Ethoxycarbonyl)pyridine-3-boronic acid?
The IUPAC name of 5-(Ethoxycarbonyl)pyridine-3-boronic acid is (5-ethoxycarbonylpyridin-3-yl)boronic acid.
What is the InChI of 5-(Ethoxycarbonyl)pyridine-3-boronic acid?
The InChI of 5-(Ethoxycarbonyl)pyridine-3-boronic acid is InChI=1S/C8H10BNO4/c1-2-14-8(11)6-3-7(9(12)13)5-10-4-6/h3-5,12-13H,2H2,1H3.
What is the InChIKey of 5-(Ethoxycarbonyl)pyridine-3-boronic acid?
The InChIKey of 5-(Ethoxycarbonyl)pyridine-3-boronic acid is ANWGKOKCTGJGCD-UHFFFAOYSA-N.
What is the canonical SMILES of 5-(Ethoxycarbonyl)pyridine-3-boronic acid?
The canonical SMILES of 5-(Ethoxycarbonyl)pyridine-3-boronic acid is B(C1=CC(=CN=C1)C(=O)OCC)(O)O.
What is the CAS number of 5-(Ethoxycarbonyl)pyridine-3-boronic acid?
The CAS number of 5-(Ethoxycarbonyl)pyridine-3-boronic acid is 875781-62-7.
How many hydrogen bond donor counts does 5-(Ethoxycarbonyl)pyridine-3-boronic acid have?
5-(Ethoxycarbonyl)pyridine-3-boronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 5-(Ethoxycarbonyl)pyridine-3-boronic acid have?
5-(Ethoxycarbonyl)pyridine-3-boronic acid has 5 hydrogen bond acceptor counts.
Recommended Products
