4-Trifluoromethylpyridine-3-boronicacid

• CAS: 947533-41-7
• Catalog Number: ACM947533417
• Category: Boro-Amino Acids
• Molecular Formula: C₆H₅BF₃NO₂xH₂O

Custom Q&A

What is the molecular formula of 4-Trifluoromethylpyridine-3-boronicacid?

The molecular formula of 4-Trifluoromethylpyridine-3-boronicacid is C6H5BF3NO2.

What is the molecular weight of 4-Trifluoromethylpyridine-3-boronicacid?

The molecular weight of 4-Trifluoromethylpyridine-3-boronicacid is 190.92 g/mol.

What is the IUPAC name of 4-Trifluoromethylpyridine-3-boronicacid?

The IUPAC name of 4-Trifluoromethylpyridine-3-boronicacid is [4-(trifluoromethyl)pyridin-3-yl]boronic acid.

What is the InChI of 4-Trifluoromethylpyridine-3-boronicacid?

The InChI of 4-Trifluoromethylpyridine-3-boronicacid is InChI=1S/C6H5BF3NO2/c8-6(9,10)4-1-2-11-3-5(4)7(12)13/h1-3,12-13H.

What is the InChIKey of 4-Trifluoromethylpyridine-3-boronicacid?

The InChIKey of 4-Trifluoromethylpyridine-3-boronicacid is GPOLKFXETWUREM-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Trifluoromethylpyridine-3-boronicacid?

The canonical SMILES of 4-Trifluoromethylpyridine-3-boronicacid is B(C1=C(C=CN=C1)C(F)(F)F)(O)O.

What is the CAS number of 4-Trifluoromethylpyridine-3-boronicacid?

The CAS number of 4-Trifluoromethylpyridine-3-boronicacid is 947533-41-7.

How many hydrogen bond donor counts does 4-Trifluoromethylpyridine-3-boronicacid have?

4-Trifluoromethylpyridine-3-boronicacid has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 4-Trifluoromethylpyridine-3-boronicacid have?

4-Trifluoromethylpyridine-3-boronicacid has 6 hydrogen bond acceptor counts.

What is the topological polar surface area of 4-Trifluoromethylpyridine-3-boronicacid?

The topological polar surface area of 4-Trifluoromethylpyridine-3-boronicacid is 53.4 Ų.