5-Bromo-3-iodo-1H-pyrazolo[3,4-b]pyridine

• CAS: 875781-18-3
• Catalog Number: ACM875781183
• Category: Bromine Series
• Molecular Formula: C₆H₃BrIN₃

Custom Q&A

What is the molecular formula of 5-Bromo-3-iodo-1H-pyrazolo[3,4-b]pyridine?

The molecular formula is C6H3BrIN3.

What is the molecular weight of 5-Bromo-3-iodo-1H-pyrazolo[3,4-b]pyridine?

The molecular weight is 323.92 g/mol.

What is the IUPAC name of 5-Bromo-3-iodo-1H-pyrazolo[3,4-b]pyridine?

The IUPAC name is 5-bromo-3-iodo-2H-pyrazolo[3,4-b]pyridine.

What is the InChI of 5-Bromo-3-iodo-1H-pyrazolo[3,4-b]pyridine?

The InChI is InChI=1S/C6H3BrIN3/c7-3-1-4-5(8)10-11-6(4)9-2-3/h1-2H,(H,9,10,11).

What is the InChI key of 5-Bromo-3-iodo-1H-pyrazolo[3,4-b]pyridine?

The InChI key is ZBPXFBHBTCYAQS-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Bromo-3-iodo-1H-pyrazolo[3,4-b]pyridine?

The canonical SMILES is C1=C(C=NC2=NNC(=C21)I)Br.

What is the CAS number of 5-Bromo-3-iodo-1H-pyrazolo[3,4-b]pyridine?

The CAS number is 875781-18-3.

What is the XLogP3-AA of 5-Bromo-3-iodo-1H-pyrazolo[3,4-b]pyridine?

The XLogP3-AA is 2.2.

What is the hydrogen bond donor count of 5-Bromo-3-iodo-1H-pyrazolo[3,4-b]pyridine?

The hydrogen bond donor count is 1.

What is the hydrogen bond acceptor count of 5-Bromo-3-iodo-1H-pyrazolo[3,4-b]pyridine?

The hydrogen bond acceptor count is 2.