2-Bromo-7-iodo-5-tosyl-5H-pyrrolo[2,3-b]pyrazine

• CAS: 875781-45-6
• Catalog Number: ACM875781456
• Category: Bromine Series
• Molecular Formula: C₁₃H₉BrIN₃O₂S
• Synonyms: 2-bromo-7-iodo-5-tosyl-5H-pyrrolo[2,3-b]pyrazine

Custom Q&A

What is the molecular formula of 2-Bromo-7-iodo-5-tosyl-5H-pyrrolo[2,3-b]pyrazine?

The molecular formula is C13H9BrIN3O2S.

What is the molecular weight of 2-Bromo-7-iodo-5-tosyl-5H-pyrrolo[2,3-b]pyrazine?

The molecular weight is 478.10 g/mol.

What is the IUPAC name of 2-Bromo-7-iodo-5-tosyl-5H-pyrrolo[2,3-b]pyrazine?

The IUPAC name is 2-bromo-7-iodo-5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazine.

What is the InChI of 2-Bromo-7-iodo-5-tosyl-5H-pyrrolo[2,3-b]pyrazine?

The InChI is InChI=1S/C13H9BrIN3O2S/c1-8-2-4-9(5-3-8)21(19,20)18-7-10(15)12-13(18)16-6-11(14)17-12/h2-7H,1H3.

What is the InChIKey of 2-Bromo-7-iodo-5-tosyl-5H-pyrrolo[2,3-b]pyrazine?

The InChIKey is QONWBLJGJMTBKI-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Bromo-7-iodo-5-tosyl-5H-pyrrolo[2,3-b]pyrazine?

The canonical SMILES is CC1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=NC(=CN=C32)Br)I.

What is the CAS number of 2-Bromo-7-iodo-5-tosyl-5H-pyrrolo[2,3-b]pyrazine?

The CAS number is 875781-45-6.

How many hydrogen bond donor counts does 2-Bromo-7-iodo-5-tosyl-5H-pyrrolo[2,3-b]pyrazine have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2-Bromo-7-iodo-5-tosyl-5H-pyrrolo[2,3-b]pyrazine have?

It has 4 hydrogen bond acceptor counts.