What is the molecular formula of 5-Bromo-2-hydroxy-3-(trifluoromethyl)benzaldehyde?
The molecular formula is C8H4BrF3O2.
What is the molecular weight of 5-Bromo-2-hydroxy-3-(trifluoromethyl)benzaldehyde?
The molecular weight is 269.01 g/mol.
What is the IUPAC name of 5-Bromo-2-hydroxy-3-(trifluoromethyl)benzaldehyde?
The IUPAC name is 5-bromo-2-hydroxy-3-(trifluoromethyl)benzaldehyde.
What is the InChI key of 5-Bromo-2-hydroxy-3-(trifluoromethyl)benzaldehyde?
The InChI key is NCOPDQCEVBJGNB-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromo-2-hydroxy-3-(trifluoromethyl)benzaldehyde?
The canonical SMILES is C1=C(C=C(C(=C1C=O)O)C(F)(F)F)Br.
What is the CAS number of 5-Bromo-2-hydroxy-3-(trifluoromethyl)benzaldehyde?
The CAS number is 251300-30-8.
What is the XLogP3-AA value of 5-Bromo-2-hydroxy-3-(trifluoromethyl)benzaldehyde?
The XLogP3-AA value is 3.2.
How many hydrogen bond donor counts does 5-Bromo-2-hydroxy-3-(trifluoromethyl)benzaldehyde have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 5-Bromo-2-hydroxy-3-(trifluoromethyl)benzaldehyde have?
It has 5 hydrogen bond acceptor counts.
How many rotatable bond counts does 5-Bromo-2-hydroxy-3-(trifluoromethyl)benzaldehyde have?
It has 1 rotatable bond count.