2-Bromo-5-iodobenzoic acid

• CAS: 25252-00-0
• Catalog Number: ACM25252000
• Category: Bromine Series
• Molecular Weight: 326.91
• Molecular Formula: C₇H₄O₂BrI

Custom Q&A

What is the molecular formula of 2-Bromo-5-iodobenzoic acid?

The molecular formula of 2-Bromo-5-iodobenzoic acid is C7H4BrIO2.

What is the molecular weight of 2-Bromo-5-iodobenzoic acid?

The molecular weight of 2-Bromo-5-iodobenzoic acid is 326.91 g/mol.

What is the IUPAC name of 2-Bromo-5-iodobenzoic acid?

The IUPAC name of 2-Bromo-5-iodobenzoic acid is 2-bromo-5-iodobenzoic acid.

What is the InChI of 2-Bromo-5-iodobenzoic acid?

The InChI of 2-Bromo-5-iodobenzoic acid is InChI=1S/C7H4BrIO2/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3H,(H,10,11).

What is the InChIKey of 2-Bromo-5-iodobenzoic acid?

The InChIKey of 2-Bromo-5-iodobenzoic acid is QPKKBDSNZFSSOD-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Bromo-5-iodobenzoic acid?

The canonical SMILES of 2-Bromo-5-iodobenzoic acid is C1=CC(=C(C=C1I)C(=O)O)Br.

What is the CAS number of 2-Bromo-5-iodobenzoic acid?

The CAS number of 2-Bromo-5-iodobenzoic acid is 25252-00-0.

What is the EC number of 2-Bromo-5-iodobenzoic acid?

The EC number of 2-Bromo-5-iodobenzoic acid is 627-996-5.

What is the XLogP3 value of 2-Bromo-5-iodobenzoic acid?

The XLogP3 value of 2-Bromo-5-iodobenzoic acid is 2.9.

Is 2-Bromo-5-iodobenzoic acid a canonicalized compound?

Yes, 2-Bromo-5-iodobenzoic acid is a canonicalized compound.