5-Bromo-2-(2,2,2-trifluoroethoxy)pyridine

• CAS: 126728-58-3
• Catalog Number: ACM126728583
• Category: Bromine Series
• Molecular Weight: 256.0199096
• Molecular Formula: C₇H₅BrF₃NO
• Synonyms: 5-BROMO-2-(2,2,2-TRIFLUORO-ETHOXY)-PYRIDINE

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C7H5BrF3NO.

What is the molecular weight of the compound?

The molecular weight of the compound is 256.02 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 5-bromo-2-(2,2,2-trifluoroethoxy)pyridine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C7H5BrF3NO/c8-5-1-2-6(12-3-5)13-4-7(9,10)11/h1-3H,4H2.

What is the InChIKey of the compound?

The InChIKey of the compound is JSYQQBQGDIUUFS-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1=CC(=NC=C1Br)OCC(F)(F)F.

What is the CAS number of the compound?

The CAS number of the compound is 126728-58-3.

What is the European Community (EC) number of the compound?

The European Community (EC) number of the compound is 868-841-3.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 3.

Is the compound canonicalized?

Yes, the compound is canonicalized.