CAS
126717-59-7 Purity
98%
126717-59-7 Purity
98%
Shopping basket
1-Bromo-3-methoxypropanol
CAS
1093758-84-9
Catalog Number
ACM1093758849
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 1-Bromo-3-methoxypropanol?
The molecular formula of 1-Bromo-3-methoxypropanol is C4H9BrO2.
What is the molecular weight of 1-Bromo-3-methoxypropanol?
The molecular weight of 1-Bromo-3-methoxypropanol is 169.02 g/mol.
What is the IUPAC name of 1-Bromo-3-methoxypropanol?
The IUPAC name of 1-Bromo-3-methoxypropanol is 1-bromo-3-methoxypropan-1-ol.
What is the InChI of 1-Bromo-3-methoxypropanol?
The InChI of 1-Bromo-3-methoxypropanol is InChI=1S/C4H9BrO2/c1-7-3-2-4(5)6/h4,6H,2-3H2,1H3.
What is the InChIKey of 1-Bromo-3-methoxypropanol?
The InChIKey of 1-Bromo-3-methoxypropanol is CKWSGLUGBCWRJF-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Bromo-3-methoxypropanol?
The canonical SMILES of 1-Bromo-3-methoxypropanol is COCCC(O)Br.
What is the CAS number of 1-Bromo-3-methoxypropanol?
The CAS number of 1-Bromo-3-methoxypropanol is 1093758-84-9.
What is the XLogP3-AA value of 1-Bromo-3-methoxypropanol?
The XLogP3-AA value of 1-Bromo-3-methoxypropanol is 0.7.
What is the hydrogen bond donor count of 1-Bromo-3-methoxypropanol?
The hydrogen bond donor count of 1-Bromo-3-methoxypropanol is 1.
What is the hydrogen bond acceptor count of 1-Bromo-3-methoxypropanol?
The hydrogen bond acceptor count of 1-Bromo-3-methoxypropanol is 2.
Recommended Products
