CAS
319009-90-0 Purity
---
319009-90-0 Purity
---
Inquiry Basket
5-(2-Hydroxypropan-2-yl)pyridin-3-ylboronicacid
CAS
1310404-56-8
Catalog Number
ACM1310404568
Category
Boro-Amino Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is [5-(2-hydroxypropan-2-yl)pyridin-3-yl]boronic acid.
What is the molecular formula of the compound?
The molecular formula of the compound is C8H12BNO3.
What is the molecular weight of the compound?
The molecular weight of the compound is 181.00 g/mol.
When was the compound created?
The compound was created on January 24, 2012.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H12BNO3/c1-8(2,11)6-3-7(9(12)13)5-10-4-6/h3-5,11-13H,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is GRDBBBJVJPPVCL-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B(C1=CC(=CN=C1)C(C)(C)O)(O)O.
What is the CAS number of the compound?
The CAS number of the compound is 1310404-56-8.
How many hydrogen bond donor counts does the compound have?
The compound has 3 hydrogen bond donor counts.
How many rotatable bond counts does the compound have?
The compound has 2 rotatable bond counts.
Recommended Products
