(4R,5R)-Fmoc-4-amino-5-tert-butoxy-hexanoic acid

• Catalog Number: ACMA00002673
• Category: Ethers
• Molecular Weight: 425.52
• Molecular Formula: C₂₃H₂₃NO₃S
• Hazard Statements: H400
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS09

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is (4R,5R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]hexanoic acid.

What is the molecular weight of the compound?

The molecular weight of the compound is 425.5 g/mol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C25H31NO5/c1-16(31-25(2,3)4)22(13-14-23(27)28)26-24(29)30-15-21-19-11-7-5-9-17(19)18-10-6-8-12-20(18)21/h5-12,16,21-22H,13-15H2,1-4H3,(H,26,29)(H,27,28)/t16-,22-/m1/s1.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC(C(CCC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C)(C).

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 2.

What is the hydrogen bond acceptor count of the compound?

The hydrogen bond acceptor count of the compound is 5.

What is the rotatable bond count of the compound?

The rotatable bond count of the compound is 10.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 84.9Ų.

What is the heavy atom count of the compound?

The heavy atom count of the compound is 31.

Is the compound canonicalized?

Yes, the compound is canonicalized.