4-Phenyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxylic acid

• Catalog Number: ACMA00001080
• Category: Amines
• Molecular Weight: 243.26
• Molecular Formula: C₁₃H₁₃NO₄
• Hazard Statements: H302
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C13H13N3O2.

What are the synonyms of the compound?

The synonyms of the compound are 178456-18-3, 4-Phenyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-6-carboxylic acid, 4-Phenyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]-pyridine-6-carboxylic acid, and 4-phenyl-3H,4H,5H,6H,7H-imidazo[4,5-c]pyridine-6-carboxylic acid.

What is the molecular weight of the compound?

The molecular weight of the compound is 243.26 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 4-phenyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-6-carboxylic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C13H13N3O2/c17-13(18)10-6-9-12(15-7-14-9)11(16-10)8-4-2-1-3-5-8/h1-5,7,10-11,16H,6H2,(H,14,15)(H,17,18).

What is the InChIKey of the compound?

The InChIKey of the compound is KFBHKNNDUHHZKT-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1C(NC(C2=C1NC=N2)C3=CC=CC=C3)C(=O)O.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is -1.4.

How many hydrogen bond donor counts does the compound have?

The compound has 3 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 4 hydrogen bond acceptor counts.