--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 2-[(4-oxocyclohexyl)methyl]isoindole-1,3-dione.
The InChI of the compound is InChI=1S/C15H15NO3/c17-11-7-5-10(6-8-11)9-16-14(18)12-3-1-2-4-13(12)15(16)19/h1-4,10H,5-9H2.
The InChIKey of the compound is CIXKYGZRROIQLQ-UHFFFAOYSA-N.
The Canonical SMILES of the compound is C1CC(=O)CCC1CN2C(=O)C3=CC=CC=C3C2=O.
The molecular weight of the compound is 257.28 g/mol.
The XLogP3 value of the compound is 1.9.
The compound has 0 hydrogen bond donor counts.
The compound has 3 hydrogen bond acceptor counts.
The compound has 2 rotatable bond counts.
The topological polar surface area of the compound is 54.4Ų.