362045-33-8 Purity
98%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 4-Methylpyridine-2-boronic acid is C6H8BNO2.
The molecular weight of 4-Methylpyridine-2-boronic acid is 136.95 g/mol.
The IUPAC name of 4-Methylpyridine-2-boronic acid is (4-methylpyridin-2-yl)boronic acid.
The InChI of 4-Methylpyridine-2-boronic acid is InChI=1S/C6H8BNO2/c1-5-2-3-8-6(4-5)7(9)10/h2-4,9-10H,1H3.
The InChIKey of 4-Methylpyridine-2-boronic acid is CGRJYCBMVWNLPD-UHFFFAOYSA-N.
The canonical SMILES of 4-Methylpyridine-2-boronic acid is B(C1=NC=CC(=C1)C)(O)O.
The CAS number of 4-Methylpyridine-2-boronic acid is 372963-48-9.
The hydrogen bond donor count of 4-Methylpyridine-2-boronic acid is 2.
The hydrogen bond acceptor count of 4-Methylpyridine-2-boronic acid is 3.
The topological polar surface area of 4-Methylpyridine-2-boronic acid is 53.4Ų.