CAS
1451393-07-9 Purity
---
1451393-07-9 Purity
---
Inquiry Basket
2,6-Dimethyl-4-isopropoxyphenylboronic acid
CAS
1192107-41-7
Catalog Number
ACM1192107417
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2,6-Dimethyl-4-isopropoxyphenylboronic acid?
The molecular formula is C11H17BO3.
What are the synonyms for 2,6-Dimethyl-4-isopropoxyphenylboronic acid?
The synonyms are 1192107-41-7, (4-Isopropoxy-2,6-dimethylphenyl)boronic acid, and 4-ISOPROPOXY-2,6-DIMETHYLPHENYLBORONIC ACID.
What is the molecular weight of 2,6-Dimethyl-4-isopropoxyphenylboronic acid?
The molecular weight is 208.06 g/mol.
What is the IUPAC name of 2,6-Dimethyl-4-isopropoxyphenylboronic acid?
The IUPAC name is (2,6-dimethyl-4-propan-2-yloxyphenyl)boronic acid.
What is the InChI of 2,6-Dimethyl-4-isopropoxyphenylboronic acid?
The InChI is InChI=1S/C11H17BO3/c1-7(2)15-10-5-8(3)11(12(13)14)9(4)6-10/h5-7,13-14H,1-4H3.
What is the InChIKey of 2,6-Dimethyl-4-isopropoxyphenylboronic acid?
The InChIKey is CDLOENHMDAFPEK-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Dimethyl-4-isopropoxyphenylboronic acid?
The canonical SMILES is B(C1=C(C=C(C=C1C)OC(C)C)C)(O)O.
How many hydrogen bond donor counts does 2,6-Dimethyl-4-isopropoxyphenylboronic acid have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2,6-Dimethyl-4-isopropoxyphenylboronic acid have?
It has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of 2,6-Dimethyl-4-isopropoxyphenylboronic acid?
The topological polar surface area is 49.7Ų.
Recommended Products
