4'-Methoxy-biphenyl-4-ylamine

• Catalog Number: ACMA00002364
• Category: Ethers
• Molecular Weight: 199.25
• Molecular Formula: C₁₃H₁₂O₃
• Hazard Statements: H318
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 4'-Methoxy-biphenyl-4-ylamine?

The molecular formula is C12H26N6O3.

What are the synonyms of 4'-Methoxy-biphenyl-4-ylamine?

The synonyms are SCHEMBL6806494, JQFZHHSQMKZLRU-UHFFFAOYSA-N, and RK FT-0773845.

What is the molecular weight of 4'-Methoxy-biphenyl-4-ylamine?

The molecular weight is 302.37 g/mol.

What is the IUPAC name of 4'-Methoxy-biphenyl-4-ylamine?

The IUPAC name is 6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid.

What is the InChI of 4'-Methoxy-biphenyl-4-ylamine?

The InChI is InChI=1S/C12H26N6O3/c13-6-2-1-5-9(11(20)21)18-10(19)8(14)4-3-7-17-12(15)16/h8-9H,1-7,13-14H2,(H,18,19)(H,20,21)(H4,15,16,17).

What is the InChIKey of 4'-Methoxy-biphenyl-4-ylamine?

The InChIKey is JQFZHHSQMKZLRU-UHFFFAOYSA-N.

What is the canonical SMILES of 4'-Methoxy-biphenyl-4-ylamine?

The canonical SMILES is C(CCN)CC(C(=O)O)NC(=O)C(CCCN=C(N)N)N.

What is the XLogP3-AA value of 4'-Methoxy-biphenyl-4-ylamine?

The XLogP3-AA value is -4.7.

How many hydrogen bond donor counts does 4'-Methoxy-biphenyl-4-ylamine have?

It has 6 hydrogen bond donor counts.

What is the topological polar surface area of 4'-Methoxy-biphenyl-4-ylamine?

The topological polar surface area is 183Ų.