--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C13H13NO.
The molecular weight of the compound is 199.25 g/mol.
The IUPAC name of the compound is 4-(4-methylphenoxy)aniline.
The InChI of the compound is InChI=1S/C13H13NO/c1-10-2-6-12(7-3-10)15-13-8-4-11(14)5-9-13/h2-9H,14H2,1H3.
The InChIKey of the compound is VPCGOYHSWIYEMO-UHFFFAOYSA-N.
The CAS number of the compound is 41295-20-9.
The compound has 1 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 35.2Ų.
The compound has 2 rotatable bond counts.