4-Methoxy-3-(pentyloxy)benzaldehyde

• Catalog Number: ACMA00002328
• Category: Ethers
• Molecular Weight: 222.28
• Molecular Formula: C₁₃H₁₇NO₄
• Hazard Statements: H318
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 4-Methoxy-3-(pentyloxy)benzaldehyde?

The molecular formula of 4-Methoxy-3-(pentyloxy)benzaldehyde is C13H18O3.

What is the molecular weight of 4-Methoxy-3-(pentyloxy)benzaldehyde?

The molecular weight of 4-Methoxy-3-(pentyloxy)benzaldehyde is 222.28 g/mol.

What is the IUPAC name of 4-Methoxy-3-(pentyloxy)benzaldehyde?

The IUPAC name of 4-Methoxy-3-(pentyloxy)benzaldehyde is 4-methoxy-3-pentoxybenzaldehyde.

What is the InChI of 4-Methoxy-3-(pentyloxy)benzaldehyde?

The InChI of 4-Methoxy-3-(pentyloxy)benzaldehyde is InChI=1S/C13H18O3/c1-3-4-5-8-16-13-9-11(10-14)6-7-12(13)15-2/h6-7,9-10H,3-5,8H2,1-2H3.

What is the InChIKey of 4-Methoxy-3-(pentyloxy)benzaldehyde?

The InChIKey of 4-Methoxy-3-(pentyloxy)benzaldehyde is RBKOEPNLFQXHJD-UHFFFAOYSA-N.

What is the Canonical SMILES of 4-Methoxy-3-(pentyloxy)benzaldehyde?

The Canonical SMILES of 4-Methoxy-3-(pentyloxy)benzaldehyde is CCCCCOC1=C(C=CC(=C1)C=O)OC.

What is the XLogP3-AA value of 4-Methoxy-3-(pentyloxy)benzaldehyde?

The XLogP3-AA value of 4-Methoxy-3-(pentyloxy)benzaldehyde is 3.1.

How many hydrogen bond donor counts does 4-Methoxy-3-(pentyloxy)benzaldehyde have?

4-Methoxy-3-(pentyloxy)benzaldehyde has 0 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 4-Methoxy-3-(pentyloxy)benzaldehyde have?

4-Methoxy-3-(pentyloxy)benzaldehyde has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does 4-Methoxy-3-(pentyloxy)benzaldehyde have?

4-Methoxy-3-(pentyloxy)benzaldehyde has 7 rotatable bond counts.