3-(Hexyloxy)benzaldehyde

• Catalog Number: ACMA00002331
• Category: Ethers
• Molecular Weight: 206.28
• Molecular Formula: C₁₃H₁₇NO₄
• Hazard Statements: H302-H411
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3-(Hexyloxy)benzaldehyde?

The molecular formula of 3-(Hexyloxy)benzaldehyde is C13H18O2.

What is the molecular weight of 3-(Hexyloxy)benzaldehyde?

The molecular weight of 3-(Hexyloxy)benzaldehyde is 206.28 g/mol.

What is the IUPAC name of 3-(Hexyloxy)benzaldehyde?

The IUPAC name of 3-(Hexyloxy)benzaldehyde is 3-hexoxybenzaldehyde.

What is the InChI of 3-(Hexyloxy)benzaldehyde?

The InChI of 3-(Hexyloxy)benzaldehyde is InChI=1S/C13H18O2/c1-2-3-4-5-9-15-13-8-6-7-12(10-13)11-14/h6-8,10-11H,2-5,9H2,1H3.

What is the InChIKey of 3-(Hexyloxy)benzaldehyde?

The InChIKey of 3-(Hexyloxy)benzaldehyde is DUKQOJQWLCELHT-UHFFFAOYSA-N.

What is the canonical SMILES of 3-(Hexyloxy)benzaldehyde?

The canonical SMILES of 3-(Hexyloxy)benzaldehyde is CCCCCCOC1=CC=CC(=C1)C=O.

What is the XLogP3 value of 3-(Hexyloxy)benzaldehyde?

The XLogP3 value of 3-(Hexyloxy)benzaldehyde is 4.

How many hydrogen bond donor counts does 3-(Hexyloxy)benzaldehyde have?

3-(Hexyloxy)benzaldehyde has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 3-(Hexyloxy)benzaldehyde have?

3-(Hexyloxy)benzaldehyde has 2 hydrogen bond acceptor counts.

How many rotatable bond counts does 3-(Hexyloxy)benzaldehyde have?

3-(Hexyloxy)benzaldehyde has 7 rotatable bond counts.