CAS
1315341-79-7 Purity
---
1315341-79-7 Purity
---
Inquiry Basket
4-Methoxy-2,5-dimethylphenylboronic acid
CAS
246023-54-1
Catalog Number
ACM246023541
Category
Boronic Acids
Molecular Weight
180.01
Molecular Formula
C9H13BO3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Methoxy-2,5-dimethylphenylboronic acid?
The molecular formula of 4-Methoxy-2,5-dimethylphenylboronic acid is C9H13BO3.
What is the molecular weight of 4-Methoxy-2,5-dimethylphenylboronic acid?
The molecular weight of 4-Methoxy-2,5-dimethylphenylboronic acid is 180.01 g/mol.
What is the IUPAC name of 4-Methoxy-2,5-dimethylphenylboronic acid?
The IUPAC name of 4-Methoxy-2,5-dimethylphenylboronic acid is (4-methoxy-2,5-dimethylphenyl)boronic acid.
What is the InChI key of 4-Methoxy-2,5-dimethylphenylboronic acid?
The InChI key of 4-Methoxy-2,5-dimethylphenylboronic acid is IUUWNGBWUJVQCF-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Methoxy-2,5-dimethylphenylboronic acid?
The canonical SMILES of 4-Methoxy-2,5-dimethylphenylboronic acid is B(C1=CC(=C(C=C1C)OC)C)(O)O.
What is the CAS number of 4-Methoxy-2,5-dimethylphenylboronic acid?
The CAS number of 4-Methoxy-2,5-dimethylphenylboronic acid is 246023-54-1.
How many hydrogen bond donor counts does 4-Methoxy-2,5-dimethylphenylboronic acid have?
4-Methoxy-2,5-dimethylphenylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-Methoxy-2,5-dimethylphenylboronic acid have?
4-Methoxy-2,5-dimethylphenylboronic acid has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does 4-Methoxy-2,5-dimethylphenylboronic acid have?
4-Methoxy-2,5-dimethylphenylboronic acid has 2 rotatable bond counts.
What is the topological polar surface area of 4-Methoxy-2,5-dimethylphenylboronic acid?
The topological polar surface area of 4-Methoxy-2,5-dimethylphenylboronic acid is 49.7Ų.
Recommended Products
