What is the molecular formula of 2,6-Dimethyl-4-ethoxyphenylboronic acid?
The molecular formula is C10H15BO3.
What is the molecular weight of 2,6-Dimethyl-4-ethoxyphenylboronic acid?
The molecular weight is 194.04 g/mol.
What is the IUPAC name of 2,6-Dimethyl-4-ethoxyphenylboronic acid?
The IUPAC name is (4-ethoxy-2,6-dimethylphenyl)boronic acid.
What is the InChI of 2,6-Dimethyl-4-ethoxyphenylboronic acid?
The InChI is InChI=1S/C10H15BO3/c1-4-14-9-5-7(2)10(11(12)13)8(3)6-9/h5-6,12-13H,4H2,1-3H3.
What is the InChIKey of 2,6-Dimethyl-4-ethoxyphenylboronic acid?
The InChIKey is GXRDZDWVEGEKPC-UHFFFAOYSA-N.
What is the Canonical SMILES of 2,6-Dimethyl-4-ethoxyphenylboronic acid?
The Canonical SMILES is B(C1=C(C=C(C=C1C)OCC)C)(O)O.
What is the CAS number of 2,6-Dimethyl-4-ethoxyphenylboronic acid?
The CAS number is 1315342-15-4.
How many hydrogen bond donor counts does 2,6-Dimethyl-4-ethoxyphenylboronic acid have?
It has 2 hydrogen bond donor counts.
What is the topological polar surface area of 2,6-Dimethyl-4-ethoxyphenylboronic acid?
The topological polar surface area is 49.7 Ų.
Is 2,6-Dimethyl-4-ethoxyphenylboronic acid a canonicalized compound?
Yes, it is a canonicalized compound.