CAS
161950-10-3 Purity
---
161950-10-3 Purity
---
Inquiry Basket
4-(Hydroxymethyl)-2-methylphenylboronic acid
CAS
166386-66-9
Catalog Number
ACM166386669
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-(Hydroxymethyl)-2-methylphenylboronic acid?
The molecular formula is C8H11BO3.
What is the molecular weight of 4-(Hydroxymethyl)-2-methylphenylboronic acid?
The molecular weight is 165.98 g/mol.
When was 4-(Hydroxymethyl)-2-methylphenylboronic acid created in PubChem?
It was created on 2012-08-08.
What is the IUPAC name of 4-(Hydroxymethyl)-2-methylphenylboronic acid?
The IUPAC name is [4-(hydroxymethyl)-2-methylphenyl]boronic acid.
What is the InChI of 4-(Hydroxymethyl)-2-methylphenylboronic acid?
The InChI is InChI=1S/C8H11BO3/c1-6-4-7(5-10)2-3-8(6)9(11)12/h2-4,10-12H,5H2,1H3.
How many hydrogen bond donor counts does 4-(Hydroxymethyl)-2-methylphenylboronic acid have?
It has 3 hydrogen bond donor counts.
What is the exact mass of 4-(Hydroxymethyl)-2-methylphenylboronic acid?
The exact mass is 166.0801244 g/mol.
How many rotatable bond counts does 4-(Hydroxymethyl)-2-methylphenylboronic acid have?
It has 2 rotatable bond counts.
Is 4-(Hydroxymethyl)-2-methylphenylboronic acid canonicalized?
Yes, the compound is canonicalized.
What is the topological polar surface area of 4-(Hydroxymethyl)-2-methylphenylboronic acid?
The topological polar surface area is 60.7Ų.
Recommended Products
CAS
1629585-65-4 Purity
---
1629585-65-4 Purity
---
