4-Fluoro-2,2,3,3,4,5,5,6,6-nonabromodiphenyl ether

• CAS: 876310-29-1
• Catalog Number: ACM876310291
• Category: Other Products
• Molecular Weight: 898.2622032
• Molecular Formula: C₁₂Br₉FO
• Synonyms: 4-FLUORO-2,2,3,3,4,5,5,6,6-NONABROMODIPHENYL ETHER;F-BDE-208

Custom Q&A

What is the molecular formula of 4-Fluoro-2,2,3,3,4,5,5,6,6-nonabromodiphenyl ether?

The molecular formula is C12Br9FO.

What is the molecular weight of 4-Fluoro-2,2,3,3,4,5,5,6,6-nonabromodiphenyl ether?

The molecular weight is 898.3 g/mol.

What is the IUPAC name of 4-Fluoro-2,2,3,3,4,5,5,6,6-nonabromodiphenyl ether?

The IUPAC name is 1,2,3,4,5-pentabromo-6-(2,3,5,6-tetrabromo-4-fluorophenoxy)benzene.

What is the InChI of 4-Fluoro-2,2,3,3,4,5,5,6,6-nonabromodiphenyl ether?

The InChI is InChI=1S/C12Br9FO/c13-1-2(14)6(18)11(7(19)3(1)15)23-12-8(20)4(16)10(22)5(17)9(12)21.

What is the InChIKey of 4-Fluoro-2,2,3,3,4,5,5,6,6-nonabromodiphenyl ether?

The InChIKey is FFXSYPMOWPFIOA-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Fluoro-2,2,3,3,4,5,5,6,6-nonabromodiphenyl ether?

The canonical SMILES is C1(=C(C(=C(C(=C1Br)Br)F)Br)Br)OC2=C(C(=C(C(=C2Br)Br)Br)Br)Br.

What is the CAS number of 4-Fluoro-2,2,3,3,4,5,5,6,6-nonabromodiphenyl ether?

The CAS number is 876310-29-1.

What is the hydrogen bond donor count of 4-Fluoro-2,2,3,3,4,5,5,6,6-nonabromodiphenyl ether?

The hydrogen bond donor count is 0.

What is the hydrogen bond acceptor count of 4-Fluoro-2,2,3,3,4,5,5,6,6-nonabromodiphenyl ether?

The hydrogen bond acceptor count is 2.

Is 4-Fluoro-2,2,3,3,4,5,5,6,6-nonabromodiphenyl ether a canonicalized compound?

Yes, it is a canonicalized compound.