CAS
957120-30-8 Purity
96%
957120-30-8 Purity
96%
Inquiry Basket
4-Ethoxy-3,5-dichlorophenylboronic acid
CAS
1107604-10-3
Catalog Number
ACM1107604103
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Ethoxy-3,5-dichlorophenylboronic acid?
The molecular formula of 4-Ethoxy-3,5-dichlorophenylboronic acid is C8H9BCl2O3.
What is the molecular weight of 4-Ethoxy-3,5-dichlorophenylboronic acid?
The molecular weight of 4-Ethoxy-3,5-dichlorophenylboronic acid is 234.87 g/mol.
What is the IUPAC name of 4-Ethoxy-3,5-dichlorophenylboronic acid?
The IUPAC name of 4-Ethoxy-3,5-dichlorophenylboronic acid is (3,5-dichloro-4-ethoxyphenyl)boronic acid.
What is the InChI of 4-Ethoxy-3,5-dichlorophenylboronic acid?
The InChI of 4-Ethoxy-3,5-dichlorophenylboronic acid is InChI=1S/C8H9BCl2O3/c1-2-14-8-6(10)3-5(9(12)13)4-7(8)11/h3-4,12-13H,2H2,1H3.
What is the InChIKey of 4-Ethoxy-3,5-dichlorophenylboronic acid?
The InChIKey of 4-Ethoxy-3,5-dichlorophenylboronic acid is IZNJKZLGWKWHGT-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Ethoxy-3,5-dichlorophenylboronic acid?
The canonical SMILES of 4-Ethoxy-3,5-dichlorophenylboronic acid is B(C1=CC(=C(C(=C1)Cl)OCC)Cl)(O)O.
What is the CAS number of 4-Ethoxy-3,5-dichlorophenylboronic acid?
The CAS number of 4-Ethoxy-3,5-dichlorophenylboronic acid is 1107604-10-3.
What is the hydrogen bond donor count of 4-Ethoxy-3,5-dichlorophenylboronic acid?
The hydrogen bond donor count of 4-Ethoxy-3,5-dichlorophenylboronic acid is 2.
What is the hydrogen bond acceptor count of 4-Ethoxy-3,5-dichlorophenylboronic acid?
The hydrogen bond acceptor count of 4-Ethoxy-3,5-dichlorophenylboronic acid is 3.
What is the topological polar surface area of 4-Ethoxy-3,5-dichlorophenylboronic acid?
The topological polar surface area of 4-Ethoxy-3,5-dichlorophenylboronic acid is 49.7Ų.
Recommended Products
