CAS
1451392-95-2 Purity
---
1451392-95-2 Purity
---
Inquiry Basket
2-Formyl-5-isopropylphenylboronic acid
CAS
1451390-89-8
Catalog Number
ACM1451390898
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Formyl-5-isopropylphenylboronic acid?
The molecular formula of 2-Formyl-5-isopropylphenylboronic acid is C10H13BO3.
What is the molecular weight of 2-Formyl-5-isopropylphenylboronic acid?
The molecular weight of 2-Formyl-5-isopropylphenylboronic acid is 192.02 g/mol.
What is the IUPAC name of 2-Formyl-5-isopropylphenylboronic acid?
The IUPAC name of 2-Formyl-5-isopropylphenylboronic acid is (2-formyl-5-propan-2-ylphenyl)boronic acid.
What is the InChI key of 2-Formyl-5-isopropylphenylboronic acid?
The InChI key of 2-Formyl-5-isopropylphenylboronic acid is OUMRDYQDMKOJKZ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Formyl-5-isopropylphenylboronic acid?
The canonical SMILES of 2-Formyl-5-isopropylphenylboronic acid is B(C1=C(C=CC(=C1)C(C)C)C=O)(O)O.
What is the CAS number of 2-Formyl-5-isopropylphenylboronic acid?
The CAS number of 2-Formyl-5-isopropylphenylboronic acid is 1451390-89-8.
What is the hydrogen bond donor count of 2-Formyl-5-isopropylphenylboronic acid?
The hydrogen bond donor count of 2-Formyl-5-isopropylphenylboronic acid is 2.
What is the hydrogen bond acceptor count of 2-Formyl-5-isopropylphenylboronic acid?
The hydrogen bond acceptor count of 2-Formyl-5-isopropylphenylboronic acid is 3.
What is the rotatable bond count of 2-Formyl-5-isopropylphenylboronic acid?
The rotatable bond count of 2-Formyl-5-isopropylphenylboronic acid is 3.
Is 2-Formyl-5-isopropylphenylboronic acid a canonicalized compound?
Yes, 2-Formyl-5-isopropylphenylboronic acid is a canonicalized compound.
Recommended Products
