4-Chloro-2-methylphenylboronic acid

• CAS: 209919-30-2
• Catalog Number: ACM209919302
• Category: Boronic Acids
• Molecular Weight: 170.40
• Molecular Formula: C₇H₈BClO₂

Custom Q&A

What is the molecular formula of 4-Chloro-2-methylphenylboronic acid?

The molecular formula is C7H8BClO2.

What is the molecular weight of 4-Chloro-2-methylphenylboronic acid?

The molecular weight is 170.40 g/mol.

What is the IUPAC name of 4-Chloro-2-methylphenylboronic acid?

The IUPAC name is (4-chloro-2-methylphenyl)boronic acid.

What is the InChI of 4-Chloro-2-methylphenylboronic acid?

The InChI is InChI=1S/C7H8BClO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4,10-11H,1H3.

What is the InChIKey of 4-Chloro-2-methylphenylboronic acid?

The InChIKey is SRXXSLUUAWHGBZ-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Chloro-2-methylphenylboronic acid?

The canonical SMILES is B(C1=C(C=C(C=C1)Cl)C)(O)O.

What is the CAS number of 4-Chloro-2-methylphenylboronic acid?

The CAS number is 209919-30-2.

What is the European Community (EC) number of 4-Chloro-2-methylphenylboronic acid?

The European Community (EC) number is 681-532-6.

What is the DSSTox Substance ID of 4-Chloro-2-methylphenylboronic acid?

The DSSTox Substance ID is DTXSID90407549.

Is 4-Chloro-2-methylphenylboronic acid a canonicalized compound in PubChem?

Yes, 4-Chloro-2-methylphenylboronic acid is a canonicalized compound in PubChem.