CAS
208641-98-9 Purity
---
208641-98-9 Purity
---
Inquiry Basket
2-Formyl-6-(trifluoromethyl)phenylboronic acid
CAS
1451392-93-0
Catalog Number
ACM1451392930
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Formyl-6-(trifluoromethyl)phenylboronic acid?
The molecular formula is C8H6BF3O3.
What is the molecular weight of 2-Formyl-6-(trifluoromethyl)phenylboronic acid?
The molecular weight is 217.94 g/mol.
What is the IUPAC name of 2-Formyl-6-(trifluoromethyl)phenylboronic acid?
The IUPAC name is [2-formyl-6-(trifluoromethyl)phenyl]boronic acid.
What is the InChI of 2-Formyl-6-(trifluoromethyl)phenylboronic acid?
The InChI is InChI=1S/C8H6BF3O3/c10-8(11,12)6-3-1-2-5(4-13)7(6)9(14)15/h1-4,14-15H.
What is the InChIKey of 2-Formyl-6-(trifluoromethyl)phenylboronic acid?
The InChIKey is VYQNGLZQQFGULH-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Formyl-6-(trifluoromethyl)phenylboronic acid?
The canonical SMILES is B(C1=C(C=CC=C1C(F)(F)F)C=O)(O)O.
What is the CAS number of 2-Formyl-6-(trifluoromethyl)phenylboronic acid?
The CAS number is 1451392-93-0.
What is the hydrogen bond donor count of 2-Formyl-6-(trifluoromethyl)phenylboronic acid?
The hydrogen bond donor count is 2.
What is the hydrogen bond acceptor count of 2-Formyl-6-(trifluoromethyl)phenylboronic acid?
The hydrogen bond acceptor count is 6.
Is 2-Formyl-6-(trifluoromethyl)phenylboronic acid a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.
Recommended Products
