4-(Bromomethyl)-2-methylpyridine

• CAS: 1167055-68-6
• Catalog Number: ACM1167055686
• Category: Pyridines
• Molecular Weight: 186.05
• Molecular Formula: C7H8BrN
• Synonyms: 2-Methyl-4-(bromomethyl)pyridine

Custom Q&A

What is the molecular formula of 4-(Bromomethyl)-2-methylpyridine?

The molecular formula is C7H8BrN.

What is the molecular weight of 4-(Bromomethyl)-2-methylpyridine?

The molecular weight is 186.05 g/mol.

What is the IUPAC name of 4-(Bromomethyl)-2-methylpyridine?

The IUPAC name is 4-(bromomethyl)-2-methylpyridine.

What is the InChI of 4-(Bromomethyl)-2-methylpyridine?

The InChI is InChI=1S/C7H8BrN/c1-6-4-7(5-8)2-3-9-6/h2-4H,5H2,1H3.

What is the InChIKey of 4-(Bromomethyl)-2-methylpyridine?

The InChIKey is MVVGGQWHXOPXRQ-UHFFFAOYSA-N.

What is the canonical SMILES of 4-(Bromomethyl)-2-methylpyridine?

The canonical SMILES is CC1=NC=CC(=C1)CBr.

What is the CAS number of 4-(Bromomethyl)-2-methylpyridine?

The CAS number is 1167055-68-6.

What is the XLogP3-AA value of 4-(Bromomethyl)-2-methylpyridine?

The XLogP3-AA value is 1.8.

How many hydrogen bond acceptor count does 4-(Bromomethyl)-2-methylpyridine have?

It has 1 hydrogen bond acceptor count.

Is 4-(Bromomethyl)-2-methylpyridine a canonicalized compound according to PubChem?

Yes, it is a canonicalized compound.