2-Chloro-3-fluoropyridin-4-amine

• CAS: 1227577-03-8
• Catalog Number: ACM1227577038
• Category: Pyridines
• Molecular Weight: 146.6
• Molecular Formula: C5H4ClFN2

Custom Q&A

What is the molecular formula of 2-Chloro-3-fluoropyridin-4-amine?

The molecular formula is C5H4ClFN2.

What is the molecular weight of 2-Chloro-3-fluoropyridin-4-amine?

The molecular weight is 146.55 g/mol.

What is the IUPAC name of 2-Chloro-3-fluoropyridin-4-amine?

The IUPAC name is 2-chloro-3-fluoropyridin-4-amine.

What is the InChI of 2-Chloro-3-fluoropyridin-4-amine?

The InChI is InChI=1S/C5H4ClFN2/c6-5-4(7)3(8)1-2-9-5/h1-2H,(H2,8,9).

What is the InChIKey of 2-Chloro-3-fluoropyridin-4-amine?

The InChIKey is VUGYOFOYGPXOFL-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Chloro-3-fluoropyridin-4-amine?

The canonical SMILES is C1=CN=C(C(=C1N)F)Cl.

What is the CAS number of 2-Chloro-3-fluoropyridin-4-amine?

The CAS number is 1227577-03-8.

What is the European Community (EC) number of 2-Chloro-3-fluoropyridin-4-amine?

The EC number is 813-094-0.

What is the DSSTox Substance ID of 2-Chloro-3-fluoropyridin-4-amine?

The DSSTox Substance ID is DTXSID60733842.

Is 2-Chloro-3-fluoropyridin-4-amine a canonical compound?

Yes, it is a canonical compound.