CAS
132426-19-8 Purity
---
132426-19-8 Purity
---
Inquiry Basket
4-(Bromomethyl)-1,3,5-trimethyl-1H-pyrazole
CAS
1341324-54-6
Catalog Number
ACM1341324546
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C7H11BrN2.
What are the synonyms for the compound?
The synonyms for the compound are 4-(bromomethyl)-1,3,5-trimethyl-1H-pyrazole, 1341324-54-6, AKOS012022071, FT-0757327, and EN300-370751.
What is the molecular weight of the compound?
The molecular weight of the compound is 203.08 g/mol.
When was the compound created?
The compound was created on December 5, 2007.
When was the compound last modified?
The compound was last modified on December 2, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-(bromomethyl)-1,3,5-trimethylpyrazole.
What is the InChI representation of the compound?
The InChI representation of the compound is InChI=1S/C7H11BrN2/c1-5-7(4-8)6(2)10(3)9-5/h4H2,1-3H3.
What is the InChIKey of the compound?
The InChIKey of the compound is OWJNOVWADAVTRX-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC1=C(C(=NN1C)C)CBr.
How many hydrogen bond donor count does the compound have?
The compound has 0 hydrogen bond donor count.
Recommended Products
