CAS
13073-25-1 Purity
---
13073-25-1 Purity
---
Inquiry Basket
5-Bromo-2-fluorobenzotrifluoride
CAS
393-37-3
Catalog Number
ACM393373
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C7H3BrF4.
What is the molecular weight of the compound?
The molecular weight of the compound is 243.00 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-bromo-1-fluoro-2-(trifluoromethyl)benzene.
What is the InChIKey of the compound?
The InChIKey of the compound is AJLIJYGWAXPEOK-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=C(C=C1Br)C(F)(F)F).
What is the CAS number of the compound?
The CAS number of the compound is 393-37-3.
What is the European Community (EC) number of the compound?
The European Community (EC) number of the compound is 642-871-5.
What is the DSSTox Substance ID of the compound?
The DSSTox Substance ID of the compound is DTXSID10371278.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 3.6.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
