4-Bromo-3-methoxyphenol

• CAS: 102127-34-4
• Catalog Number: ACM102127344
• Category: Bromine Series
• Molecular Weight: 203.03
• Molecular Formula: C₇H₇BrO₂

Custom Q&A

What is the molecular formula of 4-Bromo-3-methoxyphenol?

The molecular formula of 4-Bromo-3-methoxyphenol is C7H7BrO2.

What is the molecular weight of 4-Bromo-3-methoxyphenol?

The molecular weight of 4-Bromo-3-methoxyphenol is 203.03 g/mol.

What is the IUPAC name of 4-Bromo-3-methoxyphenol?

The IUPAC name of 4-Bromo-3-methoxyphenol is 4-bromo-3-methoxyphenol.

What is the InChI of 4-Bromo-3-methoxyphenol?

The InChI of 4-Bromo-3-methoxyphenol is InChI=1S/C7H7BrO2/c1-10-7-4-5(9)2-3-6(7)8/h2-4,9H,1H3.

What is the InChIKey of 4-Bromo-3-methoxyphenol?

The InChIKey of 4-Bromo-3-methoxyphenol is UYDZUCNMZXCLJI-UHFFFAOYSA-N.

What is the CAS number of 4-Bromo-3-methoxyphenol?

The CAS number of 4-Bromo-3-methoxyphenol is 102127-34-4.

What is the molecular weight of 4-Bromo-3-methoxyphenol calculated by PubChem?

The molecular weight of 4-Bromo-3-methoxyphenol is calculated as 203.03 g/mol by PubChem.

What is the XLogP3 value of 4-Bromo-3-methoxyphenol?

The XLogP3 value of 4-Bromo-3-methoxyphenol is 1.5.

How many hydrogen bond donor counts are there in 4-Bromo-3-methoxyphenol?

There is 1 hydrogen bond donor count in 4-Bromo-3-methoxyphenol.

How many hydrogen bond acceptor counts are there in 4-Bromo-3-methoxyphenol?

There are 2 hydrogen bond acceptor counts in 4-Bromo-3-methoxyphenol.