CAS
1017793-21-3 Purity
---
1017793-21-3 Purity
---
Inquiry Basket
2-Nitro-4-bromo-5-fluorobenzoic acid
CAS
1020717-99-0
Catalog Number
ACM1020717990
Category
Bromine Series
Molecular Weight
264.0054232
Molecular Formula
C7H3NO4BrF
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
4-BROMO-5-FLUORO-2-NITROBENZOIC ACID
What is the molecular formula of 2-Nitro-4-bromo-5-fluorobenzoic acid?
The molecular formula of 2-Nitro-4-bromo-5-fluorobenzoic acid is C7H3BrFNO4.
What is the molecular weight of 2-Nitro-4-bromo-5-fluorobenzoic acid?
The molecular weight of 2-Nitro-4-bromo-5-fluorobenzoic acid is 264.00 g/mol.
What is the IUPAC name of 2-Nitro-4-bromo-5-fluorobenzoic acid?
The IUPAC name of 2-Nitro-4-bromo-5-fluorobenzoic acid is 4-bromo-5-fluoro-2-nitrobenzoic acid.
What is the Canonical SMILES of 2-Nitro-4-bromo-5-fluorobenzoic acid?
The Canonical SMILES of 2-Nitro-4-bromo-5-fluorobenzoic acid is C1=C(C(=CC(=C1F)Br)[N+](=O)[O-])C(=O)O.
What is the InChIKey of 2-Nitro-4-bromo-5-fluorobenzoic acid?
The InChIKey of 2-Nitro-4-bromo-5-fluorobenzoic acid is JZVCMOJSPCGLTC-UHFFFAOYSA-N.
What is the Hydrogen Bond Donor Count of 2-Nitro-4-bromo-5-fluorobenzoic acid?
The Hydrogen Bond Donor Count of 2-Nitro-4-bromo-5-fluorobenzoic acid is 1.
What is the Hydrogen Bond Acceptor Count of 2-Nitro-4-bromo-5-fluorobenzoic acid?
The Hydrogen Bond Acceptor Count of 2-Nitro-4-bromo-5-fluorobenzoic acid is 5.
What is the Rotatable Bond Count of 2-Nitro-4-bromo-5-fluorobenzoic acid?
The Rotatable Bond Count of 2-Nitro-4-bromo-5-fluorobenzoic acid is 1.
Is the compound canonicalized?
Yes, the compound is canonicalized.
What is the topological polar surface area of 2-Nitro-4-bromo-5-fluorobenzoic acid?
The topological polar surface area of 2-Nitro-4-bromo-5-fluorobenzoic acid is 83.1Ų.
Recommended Products
