4-Bromo-3-Fluorobenzaldehyde

• CAS: 133059-43-5
• Catalog Number: ACM133059435
• Category: Bromine Series
• Molecular Weight: 203.01
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 4-Bromo-3-Fluorobenzaldehyde?

The molecular formula is C7H4BrFO.

What is the molecular weight of 4-Bromo-3-Fluorobenzaldehyde?

The molecular weight is 203.01 g/mol.

What is the IUPAC name of 4-Bromo-3-Fluorobenzaldehyde?

The IUPAC name is 4-bromo-3-fluorobenzaldehyde.

What is the InChI of 4-Bromo-3-Fluorobenzaldehyde?

The InChI is InChI=1S/C7H4BrFO/c8-6-2-1-5(4-10)3-7(6)9/h1-4H.

What is the InChIKey of 4-Bromo-3-Fluorobenzaldehyde?

The InChIKey is SWHUROFMIMHWKS-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Bromo-3-Fluorobenzaldehyde?

The canonical SMILES is C1=CC(=C(C=C1C=O)F)Br.

What is the CAS number of 4-Bromo-3-Fluorobenzaldehyde?

The CAS number is 133059-43-5.

What is the EC number of 4-Bromo-3-Fluorobenzaldehyde?

The EC number is 623-353-8.

What is the Wikidata ID of 4-Bromo-3-Fluorobenzaldehyde?

The Wikidata ID is Q72455743.

What is the XLogP3-AA value of 4-Bromo-3-Fluorobenzaldehyde?

The XLogP3-AA value is 2.2.