CAS
89466-18-2 Purity
---
89466-18-2 Purity
---
Inquiry Basket
4-Bromo-2-chloro-3-fluorotoluene
CAS
909122-21-0
Catalog Number
ACM909122210
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Bromo-2-chloro-3-fluorotoluene?
The molecular formula of 4-Bromo-2-chloro-3-fluorotoluene is C7H5BrClF.
What is the molecular weight of 4-Bromo-2-chloro-3-fluorotoluene?
The molecular weight of 4-Bromo-2-chloro-3-fluorotoluene is 223.47 g/mol.
What is the IUPAC name of 4-Bromo-2-chloro-3-fluorotoluene?
The IUPAC name of 4-Bromo-2-chloro-3-fluorotoluene is 1-bromo-3-chloro-2-fluoro-4-methylbenzene.
What is the InChI of 4-Bromo-2-chloro-3-fluorotoluene?
The InChI of 4-Bromo-2-chloro-3-fluorotoluene is InChI=1S/C7H5BrClF/c1-4-2-3-5(8)7(10)6(4)9/h2-3H,1H3.
What is the InChIKey of 4-Bromo-2-chloro-3-fluorotoluene?
The InChIKey of 4-Bromo-2-chloro-3-fluorotoluene is NZMSYYMOERIMAG-UHFFFAOYSA-N.
What is the canonical SMILES representation of 4-Bromo-2-chloro-3-fluorotoluene?
The canonical SMILES representation of 4-Bromo-2-chloro-3-fluorotoluene is CC1=C(C(=C(C=C1)Br)F)Cl.
What is the CAS number of 4-Bromo-2-chloro-3-fluorotoluene?
The CAS number of 4-Bromo-2-chloro-3-fluorotoluene is 909122-21-0.
What is the XLogP3-AA value of 4-Bromo-2-chloro-3-fluorotoluene?
The XLogP3-AA value of 4-Bromo-2-chloro-3-fluorotoluene is 3.7.
What is the hydrogen bond acceptor count of 4-Bromo-2-chloro-3-fluorotoluene?
The hydrogen bond acceptor count of 4-Bromo-2-chloro-3-fluorotoluene is 1.
Is 4-Bromo-2-chloro-3-fluorotoluene a canonicalized compound?
Yes, 4-Bromo-2-chloro-3-fluorotoluene is a canonicalized compound.
Recommended Products
