5-Bromo-2-dimethylaminopyridine

• CAS: 26163-07-5
• Catalog Number: ACM26163075
• Category: Bromine Series
• Molecular Formula: C₇H₉BrN₂

Custom Q&A

What is the molecular formula of 5-Bromo-2-dimethylaminopyridine?

The molecular formula is C7H9BrN2.

What is the synonym for 5-Bromo-2-dimethylaminopyridine?

The synonym is 5-bromo-N,N-dimethylpyridin-2-amine.

What is the molecular weight of 5-Bromo-2-dimethylaminopyridine?

The molecular weight is 201.06 g/mol.

When was 5-Bromo-2-dimethylaminopyridine created in PubChem?

It was created on September 11, 2005.

What is the InChI of 5-Bromo-2-dimethylaminopyridine?

The InChI is InChI=1S/C7H9BrN2/c1-10(2)7-4-3-6(8)5-9-7/h3-5H,1-2H3.

What is the InChIKey of 5-Bromo-2-dimethylaminopyridine?

The InChIKey is XIMCGXXYEMOWQP-UHFFFAOYSA-N.

What is the Canonical SMILES of 5-Bromo-2-dimethylaminopyridine?

The Canonical SMILES is CN(C)C1=NC=C(C=C1)Br.

What is the CAS number of 5-Bromo-2-dimethylaminopyridine?

The CAS number is 26163-07-5.

What is the XLogP3-AA value of 5-Bromo-2-dimethylaminopyridine?

The XLogP3-AA value is 2.

Is 5-Bromo-2-dimethylaminopyridine a canonicalized compound?

Yes, it is a canonicalized compound.