4-Bromo-1-indanone

• CAS: 15115-60-3
• Catalog Number: ACM15115603
• Category: Bromine Series

Custom Q&A

What is the molecular formula of 4-Bromo-1-indanone?

The molecular formula of 4-Bromo-1-indanone is C9H7BrO.

What is the molecular weight of 4-Bromo-1-indanone?

The molecular weight of 4-Bromo-1-indanone is 211.05 g/mol.

What is the IUPAC name of 4-Bromo-1-indanone?

The IUPAC name of 4-Bromo-1-indanone is 4-bromo-2,3-dihydroinden-1-one.

What is the InChI of 4-Bromo-1-indanone?

The InChI of 4-Bromo-1-indanone is InChI=1S/C9H7BrO/c10-8-3-1-2-7-6(8)4-5-9(7)11/h1-3H,4-5H2.

What is the InChIKey of 4-Bromo-1-indanone?

The InChIKey of 4-Bromo-1-indanone is UVVYFYLSZIMKMC-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Bromo-1-indanone?

The canonical SMILES of 4-Bromo-1-indanone is C1CC(=O)C2=C1C(=CC=C2)Br.

What is the CAS number of 4-Bromo-1-indanone?

The CAS number of 4-Bromo-1-indanone is 15115-60-3.

What is the European Community (EC) number of 4-Bromo-1-indanone?

The European Community (EC) number of 4-Bromo-1-indanone is 628-019-5.

How many hydrogen bond donor counts does 4-Bromo-1-indanone have?

4-Bromo-1-indanone has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 4-Bromo-1-indanone have?

4-Bromo-1-indanone has 1 hydrogen bond acceptor count.