--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 4-bromo-1-(difluoromethyl)-2-fluorobenzene.
The molecular formula of the compound is C7H4BrF3.
The molecular weight of the compound is 225.01 g/mol.
The InChI of the compound is InChI=1S/C7H4BrF3/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,7H.
The InChIKey of the compound is WRTTUKLMUOEXBS-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=C(C=C1Br)F)C(F)F.
The CAS number of the compound is 749932-17-0.
The XLogP3-AA value of the compound is 3.3.
The compound has 0 hydrogen bond donor counts.
The compound has 1 rotatable bond count.