2,5-Dimethylbenzyl chloride

• CAS: 824-45-3
• Catalog Number: ACM824453
• Category: Aryl
• Molecular Weight: 154.64
• Hazard Statements: H335
• RIDADR: UN 3077 9 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2,5-Dimethylbenzyl chloride?

The molecular formula is C9H11Cl.

What is the molecular weight of 2,5-Dimethylbenzyl chloride?

The molecular weight is 154.63 g/mol.

What is the IUPAC name of 2,5-Dimethylbenzyl chloride?

The IUPAC name is 2-(chloromethyl)-1,4-dimethylbenzene.

What is the InChI of 2,5-Dimethylbenzyl chloride?

The InChI is InChI=1S/C9H11Cl/c1-7-3-4-8(2)9(5-7)6-10/h3-5H,6H2,1-2H3.

What is the InChIKey of 2,5-Dimethylbenzyl chloride?

The InChIKey is PECXPZGFZFGDRD-UHFFFAOYSA-N.

What is the canonical SMILES of 2,5-Dimethylbenzyl chloride?

The canonical SMILES is CC1=CC(=C(C=C1)C)CCl.

What is the CAS number of 2,5-Dimethylbenzyl chloride?

The CAS number is 824-45-3.

What is the XLogP3-AA value of 2,5-Dimethylbenzyl chloride?

The XLogP3-AA value is 3.

How many rotatable bonds does 2,5-Dimethylbenzyl chloride have?

It has 1 rotatable bond.

Is 2,5-Dimethylbenzyl chloride a canonicalized compound?

Yes, it is a canonicalized compound.