4-Amino-2-[(tert-butoxycarbonyl)amino]-4-oxobutanoic acid

• Catalog Number: ACMA00002824
• Category: Ethers
• Molecular Weight: 232.23
• Molecular Formula: C₉H₁₃NO₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C9H16N2O5.

What is the molecular weight of the compound?

The molecular weight of the compound is 232.23 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C9H16N2O5/c1-9(2,3)16-8(15)11-5(7(13)14)4-6(10)12/h5H,4H2,1-3H3,(H2,10,12)(H,11,15)(H,13,14).

What is the InChIKey of the compound?

The InChIKey of the compound is FYYSQDHBALBGHX-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC(C)(C)OC(=O)NC(CC(=O)N)C(=O)O.

What is the CAS number of the compound?

The CAS number of the compound is 7536-55-2.

What is the EC number of the compound?

The EC number of the compound is 855-358-8.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 3.

What is the hydrogen bond acceptor count of the compound?

The hydrogen bond acceptor count of the compound is 5.